C26H26Cl2N4O3S — CID 170755779
[5-[5-[(3,4-dichlorophenyl)methyl]-1,3-oxazol-2-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]-[(1S)-2,2-dimethylcyclopropyl]methanone (PubChem CID 170755779) has the molecular formula C26H26Cl2N4O3S and a molecular weight of 545.49 g/mol. Its IUPAC name is [5-[5-[(3,4-dichlorophenyl)methyl]-1,3-oxazol-2-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]-[(1S)-2,2-dimethylcyclopropyl]methanone.
| Compound Name | [5-[5-[(3,4-dichlorophenyl)methyl]-1,3-oxazol-2-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]-[(1S)-2,2-dimethylcyclopropyl]methanone |
|---|---|
| PubChem CID | 170755779 |
| Molecular Formula | C26H26Cl2N4O3S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | [5-[5-[(3,4-dichlorophenyl)methyl]-1,3-oxazol-2-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]-[(1S)-2,2-dimethylcyclopropyl]methanone |
| SMILES | CC1(C)C[C@@H]1C(=O)N1CC2(CN(C(=O)c3cncs3)CC2c2ncc(Cc3ccc(Cl)c(Cl)c3)o2)C1 |
| InChI | InChI=1S/C26H26Cl2N4O3S/c1-25(2)7-17(25)23(33)32-12-26(13-32)11-31(24(34)21-9-29-14-36-21)10-18(26)22-30-8-16(35-22)5-15-3-4-19(27)20(28)6-15/h3-4,6,8-9,14,17-18H,5,7,10-13H2,1-2H3/t17-,18?/m1/s1 |
| InChIKey | YXVWEODSXBKXQW-QNSVNVJESA-N |
| XLogP | 5.14 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |