About 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide
2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide (PubChem CID 170755816) has the molecular formula C10H12F2N2O
and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide.
Molecular Properties
| Compound Name | 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide |
| PubChem CID | 170755816 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide |
| SMILES | Cc1ccc(C(F)(F)C(=O)NN)cc1C |
| InChI | InChI=1S/C10H12F2N2O/c1-6-3-4-8(5-7(6)2)10(11,12)9(15)14-13/h3-5H,13H2,1-2H3,(H,14,15) |
| InChIKey | GESVOAFSEYKFHY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide?
The IUPAC name of 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide (CID 170755816) is 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide.
What is the SMILES notation for 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide?
The canonical SMILES for 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide is Cc1ccc(C(F)(F)C(=O)NN)cc1C.
What is the InChIKey of 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide?
The InChIKey is GESVOAFSEYKFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2O/c1-6-3-4-8(5-7(6)2)10(11,12)9(15)14-13/h3-5H,13H2,1-2H3,(H,14,15).
What are the key properties of 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide?
2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide has a molecular weight of 214.22 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylphenyl)-2,2-difluoroacetohydrazide is sourced from PubChem (CID 170755816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).