C24H18Cl2F3N7O2S — CID 170756005
[5-[5-[(3,4-dichlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]-2-[5-(trifluoromethyl)pyrimidin-2-yl]-2,7-diazaspiro[3.4]octan-7-yl]-(1,3-thiazol-5-yl)methanone (PubChem CID 170756005) has the molecular formula C24H18Cl2F3N7O2S and a molecular weight of 596.42 g/mol. Its IUPAC name is [5-[5-[(3,4-dichlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]-2-[5-(trifluoromethyl)pyrimidin-2-yl]-2,7-diazaspiro[3.4]octan-7-yl]-(1,3-thiazol-5-yl)methanone.
| Compound Name | [5-[5-[(3,4-dichlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]-2-[5-(trifluoromethyl)pyrimidin-2-yl]-2,7-diazaspiro[3.4]octan-7-yl]-(1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 170756005 |
| Molecular Formula | C24H18Cl2F3N7O2S |
| Molecular Weight | 596.42 g/mol |
| Exact Mass | 595.06 |
| IUPAC Name | [5-[5-[(3,4-dichlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]-2-[5-(trifluoromethyl)pyrimidin-2-yl]-2,7-diazaspiro[3.4]octan-7-yl]-(1,3-thiazol-5-yl)methanone |
| SMILES | O=C(c1cncs1)N1CC(c2nnc(Cc3ccc(Cl)c(Cl)c3)o2)C2(C1)CN(c1ncc(C(F)(F)F)cn1)C2 |
| InChI | InChI=1S/C24H18Cl2F3N7O2S/c25-16-2-1-13(3-17(16)26)4-19-33-34-20(38-19)15-8-35(21(37)18-7-30-12-39-18)9-23(15)10-36(11-23)22-31-5-14(6-32-22)24(27,28)29/h1-3,5-7,12,15H,4,8-11H2 |
| InChIKey | LLRUZWQZHYKZOQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 101.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |