C24H26F6N6O3 — CID 170756290
N'-hydroxy-7-[1-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]pyrazole-4-carbonyl]-2-[1-(trifluoromethyl)cyclopropanecarbonyl]-2,7-diazaspiro[3.4]octane-5-carboximidamide (PubChem CID 170756290) has the molecular formula C24H26F6N6O3 and a molecular weight of 560.50 g/mol. Its IUPAC name is N'-hydroxy-7-[1-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]pyrazole-4-carbonyl]-2-[1-(trifluoromethyl)cyclopropanecarbonyl]-2,7-diazaspiro[3.4]octane-5-carboximidamide.
| Compound Name | N'-hydroxy-7-[1-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]pyrazole-4-carbonyl]-2-[1-(trifluoromethyl)cyclopropanecarbonyl]-2,7-diazaspiro[3.4]octane-5-carboximidamide |
|---|---|
| PubChem CID | 170756290 |
| Molecular Formula | C24H26F6N6O3 |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | N'-hydroxy-7-[1-[[4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]pyrazole-4-carbonyl]-2-[1-(trifluoromethyl)cyclopropanecarbonyl]-2,7-diazaspiro[3.4]octane-5-carboximidamide |
| SMILES | N/C(=N\O)C1CN(C(=O)c2cnn(CC3=CC=C(C(F)(F)F)CC3)c2)CC12CN(C(=O)C1(C(F)(F)F)CC1)C2 |
| InChI | InChI=1S/C24H26F6N6O3/c25-23(26,27)16-3-1-14(2-4-16)8-36-9-15(7-32-36)19(37)34-10-17(18(31)33-39)21(11-34)12-35(13-21)20(38)22(5-6-22)24(28,29)30/h1,3,7,9,17,39H,2,4-6,8,10-13H2,(H2,31,33) |
| InChIKey | WMYPNLAXVVGLER-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|