C24H22Cl2F2N6O3S — CID 170756311
[5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]-[(2R)-pyrrolidin-2-yl]methanone (PubChem CID 170756311) has the molecular formula C24H22Cl2F2N6O3S and a molecular weight of 583.45 g/mol. Its IUPAC name is [5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]-[(2R)-pyrrolidin-2-yl]methanone.
| Compound Name | [5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]-[(2R)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 170756311 |
| Molecular Formula | C24H22Cl2F2N6O3S |
| Molecular Weight | 583.45 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | [5-[5-[(3,4-dichlorophenyl)-difluoromethyl]-1,3,4-oxadiazol-2-yl]-7-(1,3-thiazole-5-carbonyl)-2,7-diazaspiro[3.4]octan-2-yl]-[(2R)-pyrrolidin-2-yl]methanone |
| SMILES | O=C(c1cncs1)N1CC(c2nnc(C(F)(F)c3ccc(Cl)c(Cl)c3)o2)C2(C1)CN(C(=O)[C@H]1CCCN1)C2 |
| InChI | InChI=1S/C24H22Cl2F2N6O3S/c25-15-4-3-13(6-16(15)26)24(27,28)22-32-31-19(37-22)14-8-33(21(36)18-7-29-12-38-18)9-23(14)10-34(11-23)20(35)17-2-1-5-30-17/h3-4,6-7,12,14,17,30H,1-2,5,8-11H2/t14?,17-/m1/s1 |
| InChIKey | WZQWHVSGJZLZLI-FBMWCMRBSA-N |
| XLogP | 3.79 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |