About 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate
2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 170756968) has the molecular formula C18H24F2O2
and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 170756968 |
| Molecular Formula | C18H24F2O2 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CC1=CC=CC(C2=CCC(F)(F)CC2)C1C(=O)OCC(C)C |
| InChI | InChI=1S/C18H24F2O2/c1-12(2)11-22-17(21)16-13(3)5-4-6-15(16)14-7-9-18(19,20)10-8-14/h4-7,12,15-16H,8-11H2,1-3H3 |
| InChIKey | XLTVRDWRAUHQMJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate (CID 170756968) is 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate is CC1=CC=CC(C2=CCC(F)(F)CC2)C1C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is XLTVRDWRAUHQMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24F2O2/c1-12(2)11-22-17(21)16-13(3)5-4-6-15(16)14-7-9-18(19,20)10-8-14/h4-7,12,15-16H,8-11H2,1-3H3.
What are the key properties of 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate?
2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 310.38 g/mol, XLogP of 4.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 6-(4,4-difluorocyclohexen-1-yl)-2-methylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 170756968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).