About ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate
ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate (PubChem CID 170757005) has the molecular formula C20H25BrF2O2
and a molecular weight of 415.32 g/mol. Its IUPAC name is ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate |
| PubChem CID | 170757005 |
| Molecular Formula | C20H25BrF2O2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate |
| SMILES | CC.CCOC(=O)C1CC1c1c(Br)cccc1C1=CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H19BrF2O2.C2H6/c1-2-23-17(22)14-10-13(14)16-12(4-3-5-15(16)19)11-6-8-18(20,21)9-7-11;1-2/h3-6,13-14H,2,7-10H2,1H3;1-2H3 |
| InChIKey | TVSRNHOEOODVJI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate?
The IUPAC name of ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate (CID 170757005) is ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate.
What is the SMILES notation for ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate?
The canonical SMILES for ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate is CC.CCOC(=O)C1CC1c1c(Br)cccc1C1=CCC(F)(F)CC1.
What is the InChIKey of ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate?
The InChIKey is TVSRNHOEOODVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrF2O2.C2H6/c1-2-23-17(22)14-10-13(14)16-12(4-3-5-15(16)19)11-6-8-18(20,21)9-7-11;1-2/h3-6,13-14H,2,7-10H2,1H3;1-2H3.
What are the key properties of ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate?
ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate has a molecular weight of 415.32 g/mol, XLogP of 6.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 2-[2-bromo-6-(4,4-difluorocyclohexen-1-yl)phenyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 170757005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).