About 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane
2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane (PubChem CID 170757040) has the molecular formula C18H30F2N4O
and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane |
| PubChem CID | 170757040 |
| Molecular Formula | C18H30F2N4O |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane |
| SMILES | CC.CCOCc1cccc(C2CCC(F)(F)CC2)c1/C(N)=N/NN |
| InChI | InChI=1S/C16H24F2N4O.C2H6/c1-2-23-10-12-4-3-5-13(14(12)15(19)21-22-20)11-6-8-16(17,18)9-7-11;1-2/h3-5,11,22H,2,6-10,20H2,1H3,(H2,19,21);1-2H3 |
| InChIKey | RQOVIWUTELATND-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane?
The IUPAC name of 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane (CID 170757040) is 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane.
What is the SMILES notation for 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane?
The canonical SMILES for 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane is CC.CCOCc1cccc(C2CCC(F)(F)CC2)c1/C(N)=N/NN.
What is the InChIKey of 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane?
The InChIKey is RQOVIWUTELATND-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24F2N4O.C2H6/c1-2-23-10-12-4-3-5-13(14(12)15(19)21-22-20)11-6-8-16(17,18)9-7-11;1-2/h3-5,11,22H,2,6-10,20H2,1H3,(H2,19,21);1-2H3.
What are the key properties of 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane?
2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane has a molecular weight of 356.46 g/mol, XLogP of 3.63, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)-N'-hydrazinylbenzenecarboximidamide;ethane is sourced from PubChem (CID 170757040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).