C16H20F2O3 — CID 170757043
5-(6,6-difluoro-3-methylidenehept-1-en-2-yl)-6-ethenyl-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 170757043) has the molecular formula C16H20F2O3 and a molecular weight of 298.33 g/mol. Its IUPAC name is 5-(6,6-difluoro-3-methylidenehept-1-en-2-yl)-6-ethenyl-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 5-(6,6-difluoro-3-methylidenehept-1-en-2-yl)-6-ethenyl-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 170757043 |
| Molecular Formula | C16H20F2O3 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-(6,6-difluoro-3-methylidenehept-1-en-2-yl)-6-ethenyl-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C=CC1=C(C(=C)C(=C)CCC(C)(F)F)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C16H20F2O3/c1-7-12-13(14(19)21-15(4,5)20-12)11(3)10(2)8-9-16(6,17)18/h7H,1-3,8-9H2,4-6H3 |
| InChIKey | MYWRSQVKNFYKDS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|