C37H46F6N2O4 — CID 170757216
tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(4,4-difluorocyclohexyl)-3-fluorobenzoate (PubChem CID 170757216) has the molecular formula C37H46F6N2O4 and a molecular weight of 696.77 g/mol. Its IUPAC name is tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(4,4-difluorocyclohexyl)-3-fluorobenzoate.
| Compound Name | tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(4,4-difluorocyclohexyl)-3-fluorobenzoate |
|---|---|
| PubChem CID | 170757216 |
| Molecular Formula | C37H46F6N2O4 |
| Molecular Weight | 696.77 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(4,4-difluorocyclohexyl)-3-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)c1c(C2CCC(F)(F)CC2)ccc(F)c1COC[C@@H]1CN(Cc2ccccc2)CC12CN(C(=O)C(C)(C)C(F)(F)F)C2 |
| InChI | InChI=1S/C37H46F6N2O4/c1-33(2,3)49-31(46)30-27(25-13-15-36(39,40)16-14-25)11-12-29(38)28(30)20-48-19-26-18-44(17-24-9-7-6-8-10-24)21-35(26)22-45(23-35)32(47)34(4,5)37(41,42)43/h6-12,25-26H,13-23H2,1-5H3/t26-/m0/s1 |
| InChIKey | JHRXNUPDJZLGQD-SANMLTNESA-N |
| XLogP | 8.14 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.77 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |