About tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate
tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate (PubChem CID 170757331) has the molecular formula C20H28F2O3
and a molecular weight of 354.44 g/mol. Its IUPAC name is tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate.
Molecular Properties
| Compound Name | tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate |
| PubChem CID | 170757331 |
| Molecular Formula | C20H28F2O3 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate |
| SMILES | CCOCc1cccc(C2CCC(F)(F)CC2)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28F2O3/c1-5-24-13-15-7-6-8-16(14-9-11-20(21,22)12-10-14)17(15)18(23)25-19(2,3)4/h6-8,14H,5,9-13H2,1-4H3 |
| InChIKey | ILYVRMHROCDART-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate?
The IUPAC name of tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate (CID 170757331) is tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate.
What is the SMILES notation for tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate?
The canonical SMILES for tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate is CCOCc1cccc(C2CCC(F)(F)CC2)c1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate?
The InChIKey is ILYVRMHROCDART-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28F2O3/c1-5-24-13-15-7-6-8-16(14-9-11-20(21,22)12-10-14)17(15)18(23)25-19(2,3)4/h6-8,14H,5,9-13H2,1-4H3.
What are the key properties of tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate?
tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate has a molecular weight of 354.44 g/mol, XLogP of 5.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(4,4-difluorocyclohexyl)-6-(ethoxymethyl)benzoate is sourced from PubChem (CID 170757331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).