C19H31F3N4O — CID 170757378
ethane;2-(ethoxymethyl)-N'-hydrazinyl-6-[4-(trifluoromethyl)cyclohexyl]benzenecarboximidamide (PubChem CID 170757378) has the molecular formula C19H31F3N4O and a molecular weight of 388.48 g/mol. Its IUPAC name is ethane;2-(ethoxymethyl)-N'-hydrazinyl-6-[4-(trifluoromethyl)cyclohexyl]benzenecarboximidamide.
| Compound Name | ethane;2-(ethoxymethyl)-N'-hydrazinyl-6-[4-(trifluoromethyl)cyclohexyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 170757378 |
| Molecular Formula | C19H31F3N4O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | ethane;2-(ethoxymethyl)-N'-hydrazinyl-6-[4-(trifluoromethyl)cyclohexyl]benzenecarboximidamide |
| SMILES | CC.CCOCc1cccc(C2CCC(C(F)(F)F)CC2)c1/C(N)=N/NN |
| InChI | InChI=1S/C17H25F3N4O.C2H6/c1-2-25-10-12-4-3-5-14(15(12)16(21)23-24-22)11-6-8-13(9-7-11)17(18,19)20;1-2/h3-5,11,13,24H,2,6-10,22H2,1H3,(H2,21,23);1-2H3 |
| InChIKey | USZCKADFKBLSAO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|