C37H47F5N2O4 — CID 170757488
tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(4,4-difluorocyclohexyl)benzoate (PubChem CID 170757488) has the molecular formula C37H47F5N2O4 and a molecular weight of 678.78 g/mol. Its IUPAC name is tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(4,4-difluorocyclohexyl)benzoate.
| Compound Name | tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(4,4-difluorocyclohexyl)benzoate |
|---|---|
| PubChem CID | 170757488 |
| Molecular Formula | C37H47F5N2O4 |
| Molecular Weight | 678.78 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | tert-butyl 2-[[(5S)-7-benzyl-2-(3,3,3-trifluoro-2,2-dimethylpropanoyl)-2,7-diazaspiro[3.4]octan-5-yl]methoxymethyl]-6-(4,4-difluorocyclohexyl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1c(COC[C@@H]2CN(Cc3ccccc3)CC23CN(C(=O)C(C)(C)C(F)(F)F)C3)cccc1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C37H47F5N2O4/c1-33(2,3)48-31(45)30-27(12-9-13-29(30)26-14-16-36(38,39)17-15-26)20-47-21-28-19-43(18-25-10-7-6-8-11-25)22-35(28)23-44(24-35)32(46)34(4,5)37(40,41)42/h6-13,26,28H,14-24H2,1-5H3/t28-/m0/s1 |
| InChIKey | FCXNOHRGMPXRQK-NDEPHWFRSA-N |
| XLogP | 8.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.78 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |