About ethanol;2-methylpropyl carbonochloridate
ethanol;2-methylpropyl carbonochloridate (PubChem CID 170757664) has the molecular formula C7H15ClO3
and a molecular weight of 182.65 g/mol. Its IUPAC name is ethanol;2-methylpropyl carbonochloridate.
Molecular Properties
| Compound Name | ethanol;2-methylpropyl carbonochloridate |
| PubChem CID | 170757664 |
| Molecular Formula | C7H15ClO3 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | ethanol;2-methylpropyl carbonochloridate |
| SMILES | CC(C)COC(=O)Cl.CCO |
| InChI | InChI=1S/C5H9ClO2.C2H6O/c1-4(2)3-8-5(6)7;1-2-3/h4H,3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | UTDAGHYESHJPEA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-methylpropyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-methylpropyl carbonochloridate?
The IUPAC name of ethanol;2-methylpropyl carbonochloridate (CID 170757664) is ethanol;2-methylpropyl carbonochloridate.
What is the SMILES notation for ethanol;2-methylpropyl carbonochloridate?
The canonical SMILES for ethanol;2-methylpropyl carbonochloridate is CC(C)COC(=O)Cl.CCO.
What is the InChIKey of ethanol;2-methylpropyl carbonochloridate?
The InChIKey is UTDAGHYESHJPEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO2.C2H6O/c1-4(2)3-8-5(6)7;1-2-3/h4H,3H2,1-2H3;3H,2H2,1H3.
What are the key properties of ethanol;2-methylpropyl carbonochloridate?
ethanol;2-methylpropyl carbonochloridate has a molecular weight of 182.65 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-methylpropyl carbonochloridate is sourced from PubChem (CID 170757664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).