About ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone
ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 170758118) has the molecular formula C8H10F3NOS
and a molecular weight of 225.23 g/mol. Its IUPAC name is ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone.
Molecular Properties
| Compound Name | ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
| PubChem CID | 170758118 |
| Molecular Formula | C8H10F3NOS |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC.CC(=O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C6H4F3NOS.C2H6/c1-3(11)4-2-10-5(12-4)6(7,8)9;1-2/h2H,1H3;1-2H3 |
| InChIKey | FEFDKUIEBXMQEU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone?
The IUPAC name of ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone (CID 170758118) is ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone.
What is the SMILES notation for ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone?
The canonical SMILES for ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone is CC.CC(=O)c1cnc(C(F)(F)F)s1.
What is the InChIKey of ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone?
The InChIKey is FEFDKUIEBXMQEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NOS.C2H6/c1-3(11)4-2-10-5(12-4)6(7,8)9;1-2/h2H,1H3;1-2H3.
What are the key properties of ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone?
ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone has a molecular weight of 225.23 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethanone is sourced from PubChem (CID 170758118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).