C20H39N3O3 — CID 170758211
(3R)-1-(3-aminopiperidin-1-yl)-3-(cyclohexylmethoxy)butan-1-one;2-methylpropanamide (PubChem CID 170758211) has the molecular formula C20H39N3O3 and a molecular weight of 369.55 g/mol. Its IUPAC name is (3R)-1-(3-aminopiperidin-1-yl)-3-(cyclohexylmethoxy)butan-1-one;2-methylpropanamide.
| Compound Name | (3R)-1-(3-aminopiperidin-1-yl)-3-(cyclohexylmethoxy)butan-1-one;2-methylpropanamide |
|---|---|
| PubChem CID | 170758211 |
| Molecular Formula | C20H39N3O3 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.30 |
| IUPAC Name | (3R)-1-(3-aminopiperidin-1-yl)-3-(cyclohexylmethoxy)butan-1-one;2-methylpropanamide |
| SMILES | CC(C)C(N)=O.C[C@H](CC(=O)N1CCCC(N)C1)OCC1CCCCC1 |
| InChI | InChI=1S/C16H30N2O2.C4H9NO/c1-13(20-12-14-6-3-2-4-7-14)10-16(19)18-9-5-8-15(17)11-18;1-3(2)4(5)6/h13-15H,2-12,17H2,1H3;3H,1-2H3,(H2,5,6)/t13-,15?;/m1./s1 |
| InChIKey | KQRHBQINQCOZPV-LKNSGBSQSA-N |
| XLogP | 2.44 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |