About ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one
ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one (PubChem CID 170758270) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one.
Molecular Properties
| Compound Name | ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one |
| PubChem CID | 170758270 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one |
| SMILES | CC(C)=O.CCOC(=O)[C@@H]1CN(C(C)=O)CC12CC=CC2 |
| InChI | InChI=1S/C13H19NO3.C3H6O/c1-3-17-12(16)11-8-14(10(2)15)9-13(11)6-4-5-7-13;1-3(2)4/h4-5,11H,3,6-9H2,1-2H3;1-2H3/t11-;/m0./s1 |
| InChIKey | RNJCTEXODDUOIP-MERQFXBCSA-N |
| XLogP | 1.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one?
The IUPAC name of ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one (CID 170758270) is ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one.
What is the SMILES notation for ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one?
The canonical SMILES for ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one is CC(C)=O.CCOC(=O)[C@@H]1CN(C(C)=O)CC12CC=CC2.
What is the InChIKey of ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one?
The InChIKey is RNJCTEXODDUOIP-MERQFXBCSA-N. The full InChI is InChI=1S/C13H19NO3.C3H6O/c1-3-17-12(16)11-8-14(10(2)15)9-13(11)6-4-5-7-13;1-3(2)4/h4-5,11H,3,6-9H2,1-2H3;1-2H3/t11-;/m0./s1.
What are the key properties of ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one?
ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one has a molecular weight of 295.38 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4S)-2-acetyl-2-azaspiro[4.4]non-7-ene-4-carboxylate;propan-2-one is sourced from PubChem (CID 170758270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).