C17H26N4O3 — CID 170758393
2-acetamido-N-methyl-2-[6-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-2-pyridinyl]acetamide;ethane (PubChem CID 170758393) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-acetamido-N-methyl-2-[6-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-2-pyridinyl]acetamide;ethane.
| Compound Name | 2-acetamido-N-methyl-2-[6-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-2-pyridinyl]acetamide;ethane |
|---|---|
| PubChem CID | 170758393 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-acetamido-N-methyl-2-[6-(2-oxa-6-azaspiro[3.3]heptan-6-yl)-2-pyridinyl]acetamide;ethane |
| SMILES | CC.CNC(=O)C(NC(C)=O)c1cccc(N2CC3(COC3)C2)n1 |
| InChI | InChI=1S/C15H20N4O3.C2H6/c1-10(20)17-13(14(21)16-2)11-4-3-5-12(18-11)19-6-15(7-19)8-22-9-15;1-2/h3-5,13H,6-9H2,1-2H3,(H,16,21)(H,17,20);1-2H3 |
| InChIKey | SVJIKBVVWPOTHL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |