About methanol;3-phenylmethoxybutanal
methanol;3-phenylmethoxybutanal (PubChem CID 170758415) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is methanol;3-phenylmethoxybutanal.
Molecular Properties
| Compound Name | methanol;3-phenylmethoxybutanal |
| PubChem CID | 170758415 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | methanol;3-phenylmethoxybutanal |
| SMILES | CC(CC=O)OCc1ccccc1.CO |
| InChI | InChI=1S/C11H14O2.CH4O/c1-10(7-8-12)13-9-11-5-3-2-4-6-11;1-2/h2-6,8,10H,7,9H2,1H3;2H,1H3 |
| InChIKey | PRXDMKHGTBBMQE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methanol;3-phenylmethoxybutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;3-phenylmethoxybutanal?
The IUPAC name of methanol;3-phenylmethoxybutanal (CID 170758415) is methanol;3-phenylmethoxybutanal.
What is the SMILES notation for methanol;3-phenylmethoxybutanal?
The canonical SMILES for methanol;3-phenylmethoxybutanal is CC(CC=O)OCc1ccccc1.CO.
What is the InChIKey of methanol;3-phenylmethoxybutanal?
The InChIKey is PRXDMKHGTBBMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.CH4O/c1-10(7-8-12)13-9-11-5-3-2-4-6-11;1-2/h2-6,8,10H,7,9H2,1H3;2H,1H3.
What are the key properties of methanol;3-phenylmethoxybutanal?
methanol;3-phenylmethoxybutanal has a molecular weight of 210.27 g/mol, XLogP of 1.79, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;3-phenylmethoxybutanal is sourced from PubChem (CID 170758415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).