About N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane
N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane (PubChem CID 170758719) has the molecular formula C19H34F2N2O4
and a molecular weight of 392.49 g/mol. Its IUPAC name is N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane.
Molecular Properties
| Compound Name | N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane |
| PubChem CID | 170758719 |
| Molecular Formula | C19H34F2N2O4 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane |
| SMILES | CC.CC(=O)NC(C(=O)N1CCC(F)(F)CC1)C(C)OCC1CCOCC1 |
| InChI | InChI=1S/C17H28F2N2O4.C2H6/c1-12(25-11-14-3-9-24-10-4-14)15(20-13(2)22)16(23)21-7-5-17(18,19)6-8-21;1-2/h12,14-15H,3-11H2,1-2H3,(H,20,22);1-2H3 |
| InChIKey | LTMGMSCDLMRZDU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane?
The IUPAC name of N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane (CID 170758719) is N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane.
What is the SMILES notation for N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane?
The canonical SMILES for N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane is CC.CC(=O)NC(C(=O)N1CCC(F)(F)CC1)C(C)OCC1CCOCC1.
What is the InChIKey of N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane?
The InChIKey is LTMGMSCDLMRZDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28F2N2O4.C2H6/c1-12(25-11-14-3-9-24-10-4-14)15(20-13(2)22)16(23)21-7-5-17(18,19)6-8-21;1-2/h12,14-15H,3-11H2,1-2H3,(H,20,22);1-2H3.
What are the key properties of N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane?
N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane has a molecular weight of 392.49 g/mol, XLogP of 2.61, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4,4-difluoropiperidin-1-yl)-3-(oxan-4-ylmethoxy)-1-oxobutan-2-yl]acetamide;ethane is sourced from PubChem (CID 170758719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).