About 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol
3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol (PubChem CID 170758733) has the molecular formula C17H33NO4
and a molecular weight of 315.45 g/mol. Its IUPAC name is 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol.
Molecular Properties
| Compound Name | 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol |
| PubChem CID | 170758733 |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol |
| SMILES | CCC(CCO)OC[C@@H](N)[C@@H](C)OCC12CCC(CC1)OC2 |
| InChI | InChI=1S/C17H33NO4/c1-3-14(6-9-19)20-10-16(18)13(2)21-11-17-7-4-15(5-8-17)22-12-17/h13-16,19H,3-12,18H2,1-2H3/t13-,14?,15?,16-,17?/m1/s1 |
| InChIKey | VGQPWSYPTABFTP-HHPWFTGOSA-N |
| XLogP | 1.86 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol?
The IUPAC name of 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol (CID 170758733) is 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol.
What is the SMILES notation for 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol?
The canonical SMILES for 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol is CCC(CCO)OC[C@@H](N)[C@@H](C)OCC12CCC(CC1)OC2.
What is the InChIKey of 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol?
The InChIKey is VGQPWSYPTABFTP-HHPWFTGOSA-N. The full InChI is InChI=1S/C17H33NO4/c1-3-14(6-9-19)20-10-16(18)13(2)21-11-17-7-4-15(5-8-17)22-12-17/h13-16,19H,3-12,18H2,1-2H3/t13-,14?,15?,16-,17?/m1/s1.
What are the key properties of 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol?
3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol has a molecular weight of 315.45 g/mol, XLogP of 1.86, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R,3R)-2-amino-3-(2-oxabicyclo[2.2.2]octan-4-ylmethoxy)butoxy]pentan-1-ol is sourced from PubChem (CID 170758733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).