C24H31N4O12P — CID 170759980
bis[3-[2-(dimethylamino)-1,1,2,2-tetrahydroxyethyl]-1H-indol-4-yl] hydrogen phosphate (PubChem CID 170759980) has the molecular formula C24H31N4O12P and a molecular weight of 598.50 g/mol. Its IUPAC name is bis[3-[2-(dimethylamino)-1,1,2,2-tetrahydroxyethyl]-1H-indol-4-yl] hydrogen phosphate.
| Compound Name | bis[3-[2-(dimethylamino)-1,1,2,2-tetrahydroxyethyl]-1H-indol-4-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 170759980 |
| Molecular Formula | C24H31N4O12P |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | bis[3-[2-(dimethylamino)-1,1,2,2-tetrahydroxyethyl]-1H-indol-4-yl] hydrogen phosphate |
| SMILES | CN(C)C(O)(O)C(O)(O)c1c[nH]c2cccc(OP(=O)(O)Oc3cccc4[nH]cc(C(O)(O)C(O)(O)N(C)C)c34)c12 |
| InChI | InChI=1S/C24H31N4O12P/c1-27(2)23(33,34)21(29,30)13-11-25-15-7-5-9-17(19(13)15)39-41(37,38)40-18-10-6-8-16-20(18)14(12-26-16)22(31,32)24(35,36)28(3)4/h5-12,25-26,29-36H,1-4H3,(H,37,38) |
| InChIKey | PLTVTFYAIBWSAA-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 255.66 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|