About ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate
ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate (PubChem CID 170760653) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate |
| PubChem CID | 170760653 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate |
| SMILES | C=C1CC(NCC(=O)OCC)CC(C)(C)C1 |
| InChI | InChI=1S/C13H23NO2/c1-5-16-12(15)9-14-11-6-10(2)7-13(3,4)8-11/h11,14H,2,5-9H2,1,3-4H3 |
| InChIKey | VYKMWKLXLOISPR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate?
The IUPAC name of ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate (CID 170760653) is ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate.
What is the SMILES notation for ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate?
The canonical SMILES for ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate is C=C1CC(NCC(=O)OCC)CC(C)(C)C1.
What is the InChIKey of ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate?
The InChIKey is VYKMWKLXLOISPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-5-16-12(15)9-14-11-6-10(2)7-13(3,4)8-11/h11,14H,2,5-9H2,1,3-4H3.
What are the key properties of ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate?
ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate has a molecular weight of 225.33 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3,3-dimethyl-5-methylidenecyclohexyl)amino]acetate is sourced from PubChem (CID 170760653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).