About 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline
4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline (PubChem CID 170761054) has the molecular formula C11H12F4N2
and a molecular weight of 248.22 g/mol. Its IUPAC name is 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline.
Molecular Properties
| Compound Name | 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline |
| PubChem CID | 170761054 |
| Molecular Formula | C11H12F4N2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline |
| SMILES | Nc1c(F)cc(N2CCC(F)(F)CC2)cc1F |
| InChI | InChI=1S/C11H12F4N2/c12-8-5-7(6-9(13)10(8)16)17-3-1-11(14,15)2-4-17/h5-6H,1-4,16H2 |
| InChIKey | QFZCDBLKFMGZHR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline?
The IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline (CID 170761054) is 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline.
What is the SMILES notation for 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline?
The canonical SMILES for 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline is Nc1c(F)cc(N2CCC(F)(F)CC2)cc1F.
What is the InChIKey of 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline?
The InChIKey is QFZCDBLKFMGZHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F4N2/c12-8-5-7(6-9(13)10(8)16)17-3-1-11(14,15)2-4-17/h5-6H,1-4,16H2.
What are the key properties of 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline?
4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline has a molecular weight of 248.22 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluoropiperidin-1-yl)-2,6-difluoroaniline is sourced from PubChem (CID 170761054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).