C22H21FN4O2 — CID 170762375
2-[[4-[3-(3-fluoro-2-methoxyphenyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-3-pyridinyl]oxy]-N-methylethanamine (PubChem CID 170762375) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-[[4-[3-(3-fluoro-2-methoxyphenyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-3-pyridinyl]oxy]-N-methylethanamine.
| Compound Name | 2-[[4-[3-(3-fluoro-2-methoxyphenyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-3-pyridinyl]oxy]-N-methylethanamine |
|---|---|
| PubChem CID | 170762375 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[[4-[3-(3-fluoro-2-methoxyphenyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]-3-pyridinyl]oxy]-N-methylethanamine |
| SMILES | CNCCOc1cnccc1-c1[nH]c2cccnc2c1-c1cccc(F)c1OC |
| InChI | InChI=1S/C22H21FN4O2/c1-24-11-12-29-18-13-25-10-8-14(18)20-19(21-17(27-20)7-4-9-26-21)15-5-3-6-16(23)22(15)28-2/h3-10,13,24,27H,11-12H2,1-2H3 |
| InChIKey | NOAZIHNDUFDZEM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|