C21H24ClN3O2 — CID 170762875
4-[[2-chloro-5-(2-cyclopropylethynyl)phenyl]methyl]-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]triazole (PubChem CID 170762875) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 4-[[2-chloro-5-(2-cyclopropylethynyl)phenyl]methyl]-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]triazole.
| Compound Name | 4-[[2-chloro-5-(2-cyclopropylethynyl)phenyl]methyl]-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]triazole |
|---|---|
| PubChem CID | 170762875 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-[[2-chloro-5-(2-cyclopropylethynyl)phenyl]methyl]-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]triazole |
| SMILES | CC1(C)COC(Cn2cc(Cc3cc(C#CC4CC4)ccc3Cl)nn2)OC1 |
| InChI | InChI=1S/C21H24ClN3O2/c1-21(2)13-26-20(27-14-21)12-25-11-18(23-24-25)10-17-9-16(7-8-19(17)22)6-5-15-3-4-15/h7-9,11,15,20H,3-4,10,12-14H2,1-2H3 |
| InChIKey | GLKHLORTGWRSKH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|