C21H25N3O2 — CID 170763077
4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]triazole (PubChem CID 170763077) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]triazole.
| Compound Name | 4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]triazole |
|---|---|
| PubChem CID | 170763077 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[2-[4-(cyclopropylmethyl)phenyl]ethynyl]-1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]triazole |
| SMILES | CC1(C)COC(Cn2cc(C#Cc3ccc(CC4CC4)cc3)nn2)OC1 |
| InChI | InChI=1S/C21H25N3O2/c1-21(2)14-25-20(26-15-21)13-24-12-19(22-23-24)10-9-16-3-5-17(6-4-16)11-18-7-8-18/h3-6,12,18,20H,7-8,11,13-15H2,1-2H3 |
| InChIKey | ZCXOVYVXSQSMOG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|