About 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine
1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine (PubChem CID 170763097) has the molecular formula C17H24N4O3
and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine.
Molecular Properties
| Compound Name | 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine |
| PubChem CID | 170763097 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine |
| SMILES | COc1ccc(N(C)c2cn(CC3OCC(C)(C)CO3)nn2)cc1 |
| InChI | InChI=1S/C17H24N4O3/c1-17(2)11-23-16(24-12-17)10-21-9-15(18-19-21)20(3)13-5-7-14(22-4)8-6-13/h5-9,16H,10-12H2,1-4H3 |
| InChIKey | HEAKEVVYOFFSHU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine?
The IUPAC name of 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine (CID 170763097) is 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine.
What is the SMILES notation for 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine?
The canonical SMILES for 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine is COc1ccc(N(C)c2cn(CC3OCC(C)(C)CO3)nn2)cc1.
What is the InChIKey of 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine?
The InChIKey is HEAKEVVYOFFSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O3/c1-17(2)11-23-16(24-12-17)10-21-9-15(18-19-21)20(3)13-5-7-14(22-4)8-6-13/h5-9,16H,10-12H2,1-4H3.
What are the key properties of 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine?
1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine has a molecular weight of 332.40 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-N-(4-methoxyphenyl)-N-methyltriazol-4-amine is sourced from PubChem (CID 170763097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).