C14H23NO3 — CID 170763553
2-[[(3Z,5Z)-4-ethoxyhepta-1,3,5-trien-3-yl]oxymethyl]morpholine (PubChem CID 170763553) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-[[(3Z,5Z)-4-ethoxyhepta-1,3,5-trien-3-yl]oxymethyl]morpholine.
| Compound Name | 2-[[(3Z,5Z)-4-ethoxyhepta-1,3,5-trien-3-yl]oxymethyl]morpholine |
|---|---|
| PubChem CID | 170763553 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-[[(3Z,5Z)-4-ethoxyhepta-1,3,5-trien-3-yl]oxymethyl]morpholine |
| SMILES | C=C/C(OCC1CNCCO1)=C(\C=C/C)OCC |
| InChI | InChI=1S/C14H23NO3/c1-4-7-14(16-6-3)13(5-2)18-11-12-10-15-8-9-17-12/h4-5,7,12,15H,2,6,8-11H2,1,3H3/b7-4-,14-13- |
| InChIKey | QWBRHZNPSXOROA-YCWRBDDXSA-N |
| XLogP | 2.00 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|