C33H61N — CID 170763940
5,5-dimethyl-3-methylidene-N-(2-methylprop-2-enyl)cyclohexen-1-amine;ethane;1-methyl-4-nonylcyclohexa-1,3-diene (PubChem CID 170763940) has the molecular formula C33H61N and a molecular weight of 471.86 g/mol. Its IUPAC name is 5,5-dimethyl-3-methylidene-N-(2-methylprop-2-enyl)cyclohexen-1-amine;ethane;1-methyl-4-nonylcyclohexa-1,3-diene.
| Compound Name | 5,5-dimethyl-3-methylidene-N-(2-methylprop-2-enyl)cyclohexen-1-amine;ethane;1-methyl-4-nonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 170763940 |
| Molecular Formula | C33H61N |
| Molecular Weight | 471.86 g/mol |
| Exact Mass | 471.48 |
| IUPAC Name | 5,5-dimethyl-3-methylidene-N-(2-methylprop-2-enyl)cyclohexen-1-amine;ethane;1-methyl-4-nonylcyclohexa-1,3-diene |
| SMILES | C=C(C)CNC1=CC(=C)CC(C)(C)C1.CC.CC.CCCCCCCCCC1=CC=C(C)CC1 |
| InChI | InChI=1S/C16H28.C13H21N.2C2H6/c1-3-4-5-6-7-8-9-10-16-13-11-15(2)12-14-16;1-10(2)9-14-12-6-11(3)7-13(4,5)8-12;2*1-2/h11,13H,3-10,12,14H2,1-2H3;6,14H,1,3,7-9H2,2,4-5H3;2*1-2H3 |
| InChIKey | TWCKHACELVPUIX-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.86 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|