About tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate
tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate (PubChem CID 170764345) has the molecular formula C17H21BrF2N2O4
and a molecular weight of 435.27 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate |
| PubChem CID | 170764345 |
| Molecular Formula | C17H21BrF2N2O4 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@@H]1C(=O)NCc1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C17H21BrF2N2O4/c1-17(2,3)26-16(24)22-4-5-25-9-13(22)15(23)21-8-10-6-11(19)14(18)12(20)7-10/h6-7,13H,4-5,8-9H2,1-3H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | WECOQAREPBJMTK-CYBMUJFWSA-N |
| XLogP | 2.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate?
The IUPAC name of tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate (CID 170764345) is tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate.
What is the SMILES notation for tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate?
The canonical SMILES for tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate is CC(C)(C)OC(=O)N1CCOC[C@@H]1C(=O)NCc1cc(F)c(Br)c(F)c1.
What is the InChIKey of tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate?
The InChIKey is WECOQAREPBJMTK-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H21BrF2N2O4/c1-17(2,3)26-16(24)22-4-5-25-9-13(22)15(23)21-8-10-6-11(19)14(18)12(20)7-10/h6-7,13H,4-5,8-9H2,1-3H3,(H,21,23)/t13-/m1/s1.
What are the key properties of tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate?
tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate has a molecular weight of 435.27 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R)-3-[(4-bromo-3,5-difluorophenyl)methylcarbamoyl]morpholine-4-carboxylate is sourced from PubChem (CID 170764345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).