C23H31N3O6 — CID 170765983
4-amino-5-[cyclohexylmethoxy(phenyl)methyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 170765983) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-amino-5-[cyclohexylmethoxy(phenyl)methyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-[cyclohexylmethoxy(phenyl)methyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 170765983 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 4-amino-5-[cyclohexylmethoxy(phenyl)methyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1C(OCC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O6/c24-21-16(11-26(23(30)25-21)22-19(29)18(28)17(12-27)32-22)20(15-9-5-2-6-10-15)31-13-14-7-3-1-4-8-14/h2,5-6,9-11,14,17-20,22,27-29H,1,3-4,7-8,12-13H2,(H2,24,25,30)/t17-,18-,19-,20?,22-/m1/s1 |
| InChIKey | AIGPVFIGKHVTHB-FKWVCDEGSA-N |
| XLogP | 1.12 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |