C22H25N3O7 — CID 170766305
2,2,3,3,3-pentahydroxy-N-[(8R)-4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5,6,7,8-tetrahydroisoquinolin-8-yl]propanamide (PubChem CID 170766305) has the molecular formula C22H25N3O7 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2,2,3,3,3-pentahydroxy-N-[(8R)-4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5,6,7,8-tetrahydroisoquinolin-8-yl]propanamide.
| Compound Name | 2,2,3,3,3-pentahydroxy-N-[(8R)-4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5,6,7,8-tetrahydroisoquinolin-8-yl]propanamide |
|---|---|
| PubChem CID | 170766305 |
| Molecular Formula | C22H25N3O7 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2,2,3,3,3-pentahydroxy-N-[(8R)-4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-5,6,7,8-tetrahydroisoquinolin-8-yl]propanamide |
| SMILES | CN1C(=O)CCc2cc(-c3cncc4c3CCC[C@H]4NC(=O)C(O)(O)C(O)(O)O)ccc21 |
| InChI | InChI=1S/C22H25N3O7/c1-25-18-7-5-12(9-13(18)6-8-19(25)26)15-10-23-11-16-14(15)3-2-4-17(16)24-20(27)21(28,29)22(30,31)32/h5,7,9-11,17,28-32H,2-4,6,8H2,1H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | PPPOZLUGAXECQC-QGZVFWFLSA-N |
| XLogP | -0.54 |
| TPSA | 163.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|