About 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate
1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate (PubChem CID 170766739) has the molecular formula C11H18F3NO2
and a molecular weight of 253.26 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate |
| PubChem CID | 170766739 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate |
| SMILES | CCCC1CCN(C(=O)OC(C)C(F)(F)F)C1 |
| InChI | InChI=1S/C11H18F3NO2/c1-3-4-9-5-6-15(7-9)10(16)17-8(2)11(12,13)14/h8-9H,3-7H2,1-2H3 |
| InChIKey | KJBDYPFIOQIIEX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate?
The IUPAC name of 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate (CID 170766739) is 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate.
What is the SMILES notation for 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate?
The canonical SMILES for 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate is CCCC1CCN(C(=O)OC(C)C(F)(F)F)C1.
What is the InChIKey of 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate?
The InChIKey is KJBDYPFIOQIIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO2/c1-3-4-9-5-6-15(7-9)10(16)17-8(2)11(12,13)14/h8-9H,3-7H2,1-2H3.
What are the key properties of 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate?
1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate has a molecular weight of 253.26 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trifluoropropan-2-yl 3-propylpyrrolidine-1-carboxylate is sourced from PubChem (CID 170766739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).