C8H14N2O2 — CID 170767792
(6S,7aS)-6-(ethylamino)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 170767792) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (6S,7aS)-6-(ethylamino)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (6S,7aS)-6-(ethylamino)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 170767792 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (6S,7aS)-6-(ethylamino)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | CCN[C@H]1C[C@H]2COC(=O)N2C1 |
| InChI | InChI=1S/C8H14N2O2/c1-2-9-6-3-7-5-12-8(11)10(7)4-6/h6-7,9H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | NRSXQRKQYGYIPG-BQBZGAKWSA-N |
| XLogP | 0.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |