C37H39B2F6N7O2S — CID 170767850
CID 170767850 (PubChem CID 170767850) has the molecular formula C37H39B2F6N7O2S and a molecular weight of 781.45 g/mol.
| Compound Name | CID 170767850 |
|---|---|
| PubChem CID | 170767850 |
| Molecular Formula | C37H39B2F6N7O2S |
| Molecular Weight | 781.45 g/mol |
| Exact Mass | 781.30 |
| IUPAC Name | — |
| SMILES | COc1nc(N(C)C2CCN(C)C2C)c2cc(C(F)(F)F)c(-c3ccc(F)c4sc(N)c(C#N)c34)c(F)c2n1.O=CC1CC1.[B]C1([B])CC2CC(F)CN2C1 |
| InChI | InChI=1S/C26H23F5N6OS.C7H10B2FN.C4H6O/c1-11-17(7-8-36(11)2)37(3)24-13-9-15(26(29,30)31)19(20(28)21(13)34-25(35-24)38-4)12-5-6-16(27)22-18(12)14(10-32)23(33)39-22;8-7(9)2-6-1-5(10)3-11(6)4-7;5-3-4-1-2-4/h5-6,9,11,17H,7-8,33H2,1-4H3;5-6H,1-4H2;3-4H,1-2H2 |
| InChIKey | QFTVVAQMGIJRSZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.45 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|