About oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate
oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate (PubChem CID 170768301) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate |
| PubChem CID | 170768301 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)OC2CCOC2)C1C |
| InChI | InChI=1S/C11H19NO3/c1-8-3-5-12(9(8)2)11(13)15-10-4-6-14-7-10/h8-10H,3-7H2,1-2H3 |
| InChIKey | VIJUVUURTFHQTJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate?
The IUPAC name of oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate (CID 170768301) is oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate.
What is the SMILES notation for oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate?
The canonical SMILES for oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate is CC1CCN(C(=O)OC2CCOC2)C1C.
What is the InChIKey of oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate?
The InChIKey is VIJUVUURTFHQTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-8-3-5-12(9(8)2)11(13)15-10-4-6-14-7-10/h8-10H,3-7H2,1-2H3.
What are the key properties of oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate?
oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 2,3-dimethylpyrrolidine-1-carboxylate is sourced from PubChem (CID 170768301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).