C36H36BF6N7O2S — CID 170768529
CID 170768529 (PubChem CID 170768529) has the molecular formula C36H36BF6N7O2S and a molecular weight of 755.60 g/mol.
| Compound Name | CID 170768529 |
|---|---|
| PubChem CID | 170768529 |
| Molecular Formula | C36H36BF6N7O2S |
| Molecular Weight | 755.60 g/mol |
| Exact Mass | 755.26 |
| IUPAC Name | — |
| SMILES | [B]C1(N(CC)c2nc(OCC34CCCN3CC(F)C4)nc3c(F)c(-c4ccc(F)c5sc(N)c(C#N)c45)c(C(F)(F)F)cc23)CCN(C(=O)C(C)C)C1 |
| InChI | InChI=1S/C36H36BF6N7O2S/c1-4-50(35(37)9-11-48(16-35)32(51)18(2)3)31-21-12-23(36(41,42)43)26(20-6-7-24(39)29-25(20)22(14-44)30(45)53-29)27(40)28(21)46-33(47-31)52-17-34-8-5-10-49(34)15-19(38)13-34/h6-7,12,18-19H,4-5,8-11,13,15-17,45H2,1-3H3 |
| InChIKey | HWCXDBZMIPXWDW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|