C18H21ClF3NO3S — CID 170769687
2-amino-4-[3-[4-(3-chlorobuta-1,3-dien-2-yl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid (PubChem CID 170769687) has the molecular formula C18H21ClF3NO3S and a molecular weight of 423.88 g/mol. Its IUPAC name is 2-amino-4-[3-[4-(3-chlorobuta-1,3-dien-2-yl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-[4-(3-chlorobuta-1,3-dien-2-yl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170769687 |
| Molecular Formula | C18H21ClF3NO3S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 2-amino-4-[3-[4-(3-chlorobuta-1,3-dien-2-yl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
| SMILES | C=C(Cl)C(=C)c1ccc(C(O)(CCSCCC(N)C(=O)O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21ClF3NO3S/c1-11(12(2)19)13-3-5-14(6-4-13)17(26,18(20,21)22)8-10-27-9-7-15(23)16(24)25/h3-6,15,26H,1-2,7-10,23H2,(H,24,25) |
| InChIKey | BPGBPCPGLNRKFQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|