C15H17F6NO3S — CID 170769696
2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-[4-(trifluoromethyl)phenyl]butyl]sulfanylbutanoic acid (PubChem CID 170769696) has the molecular formula C15H17F6NO3S and a molecular weight of 405.36 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-[4-(trifluoromethyl)phenyl]butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-[4-(trifluoromethyl)phenyl]butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170769696 |
| Molecular Formula | C15H17F6NO3S |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-[4-(trifluoromethyl)phenyl]butyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(O)(c1ccc(C(F)(F)F)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H17F6NO3S/c16-14(17,18)10-3-1-9(2-4-10)13(25,15(19,20)21)6-8-26-7-5-11(22)12(23)24/h1-4,11,25H,5-8,22H2,(H,23,24) |
| InChIKey | DQEBXHPVSDHMCS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|