C19H21F6NO2S — CID 170769735
2-amino-4-[4,4,4-trifluoro-3-[4-[3-(trifluoromethyl)buta-1,3-dien-2-yl]phenyl]butyl]sulfanylbutanoic acid (PubChem CID 170769735) has the molecular formula C19H21F6NO2S and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-[4-[3-(trifluoromethyl)buta-1,3-dien-2-yl]phenyl]butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-[4-[3-(trifluoromethyl)buta-1,3-dien-2-yl]phenyl]butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170769735 |
| Molecular Formula | C19H21F6NO2S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-[4-[3-(trifluoromethyl)buta-1,3-dien-2-yl]phenyl]butyl]sulfanylbutanoic acid |
| SMILES | C=C(C(=C)C(F)(F)F)c1ccc(C(CCSCCC(N)C(=O)O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H21F6NO2S/c1-11(12(2)18(20,21)22)13-3-5-14(6-4-13)15(19(23,24)25)7-9-29-10-8-16(26)17(27)28/h3-6,15-16H,1-2,7-10,26H2,(H,27,28) |
| InChIKey | HISQCIKYNBIZQH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|