C15H20F3NO2S — CID 170769739
2-amino-4-(4,4,4-trifluoro-3-methyl-3-phenylbutyl)sulfanylbutanoic acid (PubChem CID 170769739) has the molecular formula C15H20F3NO2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-amino-4-(4,4,4-trifluoro-3-methyl-3-phenylbutyl)sulfanylbutanoic acid.
| Compound Name | 2-amino-4-(4,4,4-trifluoro-3-methyl-3-phenylbutyl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170769739 |
| Molecular Formula | C15H20F3NO2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-amino-4-(4,4,4-trifluoro-3-methyl-3-phenylbutyl)sulfanylbutanoic acid |
| SMILES | CC(CCSCCC(N)C(=O)O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H20F3NO2S/c1-14(15(16,17)18,11-5-3-2-4-6-11)8-10-22-9-7-12(19)13(20)21/h2-6,12H,7-10,19H2,1H3,(H,20,21) |
| InChIKey | XOIGOKPWKPBBAY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|