C16H18F3N3O3S — CID 170769917
2-amino-4-[4,4,4-trifluoro-3-[5-(1,3-oxazol-5-yl)-2-pyridinyl]butyl]sulfanylbutanoic acid (PubChem CID 170769917) has the molecular formula C16H18F3N3O3S and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-[5-(1,3-oxazol-5-yl)-2-pyridinyl]butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-[5-(1,3-oxazol-5-yl)-2-pyridinyl]butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170769917 |
| Molecular Formula | C16H18F3N3O3S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-[5-(1,3-oxazol-5-yl)-2-pyridinyl]butyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(c1ccc(-c2cnco2)cn1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H18F3N3O3S/c17-16(18,19)11(3-5-26-6-4-12(20)15(23)24)13-2-1-10(7-22-13)14-8-21-9-25-14/h1-2,7-9,11-12H,3-6,20H2,(H,23,24) |
| InChIKey | CNSHXKXWONLTTG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|