C20H22F4N2O3S — CID 170770088
2-amino-4-[4,4,4-trifluoro-3-[5-(4-fluoro-2-methylphenyl)-2-pyridinyl]-3-hydroxybutyl]sulfanylbutanoic acid (PubChem CID 170770088) has the molecular formula C20H22F4N2O3S and a molecular weight of 446.47 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-[5-(4-fluoro-2-methylphenyl)-2-pyridinyl]-3-hydroxybutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-[5-(4-fluoro-2-methylphenyl)-2-pyridinyl]-3-hydroxybutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770088 |
| Molecular Formula | C20H22F4N2O3S |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-[5-(4-fluoro-2-methylphenyl)-2-pyridinyl]-3-hydroxybutyl]sulfanylbutanoic acid |
| SMILES | Cc1cc(F)ccc1-c1ccc(C(O)(CCSCCC(N)C(=O)O)C(F)(F)F)nc1 |
| InChI | InChI=1S/C20H22F4N2O3S/c1-12-10-14(21)3-4-15(12)13-2-5-17(26-11-13)19(29,20(22,23)24)7-9-30-8-6-16(25)18(27)28/h2-5,10-11,16,29H,6-9,25H2,1H3,(H,27,28) |
| InChIKey | MOROIPKWMHBBSR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|