C20H26F3NO2S2 — CID 170770137
2-amino-4-[4,4,4-trifluoro-3-(4-thiophen-3-ylphenyl)butyl]sulfanylbutanoic acid;ethane (PubChem CID 170770137) has the molecular formula C20H26F3NO2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-(4-thiophen-3-ylphenyl)butyl]sulfanylbutanoic acid;ethane.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-(4-thiophen-3-ylphenyl)butyl]sulfanylbutanoic acid;ethane |
|---|---|
| PubChem CID | 170770137 |
| Molecular Formula | C20H26F3NO2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-(4-thiophen-3-ylphenyl)butyl]sulfanylbutanoic acid;ethane |
| SMILES | CC.NC(CCSCCC(c1ccc(-c2ccsc2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C18H20F3NO2S2.C2H6/c19-18(20,21)15(6-9-25-10-7-16(22)17(23)24)13-3-1-12(2-4-13)14-5-8-26-11-14;1-2/h1-5,8,11,15-16H,6-7,9-10,22H2,(H,23,24);1-2H3 |
| InChIKey | DEQJLCNKDLHLQK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|