C18H20F3NO2S2 — CID 170770138
2-amino-4-[4,4,4-trifluoro-3-(4-thiophen-3-ylphenyl)butyl]sulfanylbutanoic acid (PubChem CID 170770138) has the molecular formula C18H20F3NO2S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-(4-thiophen-3-ylphenyl)butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-(4-thiophen-3-ylphenyl)butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770138 |
| Molecular Formula | C18H20F3NO2S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-(4-thiophen-3-ylphenyl)butyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(c1ccc(-c2ccsc2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C18H20F3NO2S2/c19-18(20,21)15(6-9-25-10-7-16(22)17(23)24)13-3-1-12(2-4-13)14-5-8-26-11-14/h1-5,8,11,15-16H,6-7,9-10,22H2,(H,23,24) |
| InChIKey | AYDRUBJHIQFHMP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|