C20H19Cl2F4NO3S — CID 170770177
2-amino-4-[3-[4-(2,4-dichlorophenyl)-2-fluorophenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid (PubChem CID 170770177) has the molecular formula C20H19Cl2F4NO3S and a molecular weight of 500.34 g/mol. Its IUPAC name is 2-amino-4-[3-[4-(2,4-dichlorophenyl)-2-fluorophenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-[4-(2,4-dichlorophenyl)-2-fluorophenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770177 |
| Molecular Formula | C20H19Cl2F4NO3S |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 2-amino-4-[3-[4-(2,4-dichlorophenyl)-2-fluorophenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(O)(c1ccc(-c2ccc(Cl)cc2Cl)cc1F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H19Cl2F4NO3S/c21-12-2-3-13(15(22)10-12)11-1-4-14(16(23)9-11)19(30,20(24,25)26)6-8-31-7-5-17(27)18(28)29/h1-4,9-10,17,30H,5-8,27H2,(H,28,29) |
| InChIKey | YWNKSQKZLAEIDS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|