C9H14F3N3OS — CID 170770447
1-(1,2,4-oxadiazol-5-yl)-3-(4,4,4-trifluorobutylsulfanyl)propan-1-amine (PubChem CID 170770447) has the molecular formula C9H14F3N3OS and a molecular weight of 269.29 g/mol. Its IUPAC name is 1-(1,2,4-oxadiazol-5-yl)-3-(4,4,4-trifluorobutylsulfanyl)propan-1-amine.
| Compound Name | 1-(1,2,4-oxadiazol-5-yl)-3-(4,4,4-trifluorobutylsulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 170770447 |
| Molecular Formula | C9H14F3N3OS |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-(1,2,4-oxadiazol-5-yl)-3-(4,4,4-trifluorobutylsulfanyl)propan-1-amine |
| SMILES | NC(CCSCCCC(F)(F)F)c1ncno1 |
| InChI | InChI=1S/C9H14F3N3OS/c10-9(11,12)3-1-4-17-5-2-7(13)8-14-6-15-16-8/h6-7H,1-5,13H2 |
| InChIKey | DNDCHKXDXGGXDG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|