C18H24Cl2F3N3O2S — CID 170770489
2-amino-4-[3-[4-(2,4-dichlorophenyl)piperazin-1-yl]-4,4,4-trifluorobutyl]sulfanylbutanoic acid (PubChem CID 170770489) has the molecular formula C18H24Cl2F3N3O2S and a molecular weight of 474.38 g/mol. Its IUPAC name is 2-amino-4-[3-[4-(2,4-dichlorophenyl)piperazin-1-yl]-4,4,4-trifluorobutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-[4-(2,4-dichlorophenyl)piperazin-1-yl]-4,4,4-trifluorobutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770489 |
| Molecular Formula | C18H24Cl2F3N3O2S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 2-amino-4-[3-[4-(2,4-dichlorophenyl)piperazin-1-yl]-4,4,4-trifluorobutyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(N1CCN(c2ccc(Cl)cc2Cl)CC1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C18H24Cl2F3N3O2S/c19-12-1-2-15(13(20)11-12)25-5-7-26(8-6-25)16(18(21,22)23)4-10-29-9-3-14(24)17(27)28/h1-2,11,14,16H,3-10,24H2,(H,27,28) |
| InChIKey | USLFDYONNNZQHP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|