C19H27F3N2O3S — CID 170770544
2-amino-4-[3-(5-cyclohexyl-2-pyridinyl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid (PubChem CID 170770544) has the molecular formula C19H27F3N2O3S and a molecular weight of 420.50 g/mol. Its IUPAC name is 2-amino-4-[3-(5-cyclohexyl-2-pyridinyl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-(5-cyclohexyl-2-pyridinyl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770544 |
| Molecular Formula | C19H27F3N2O3S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-amino-4-[3-(5-cyclohexyl-2-pyridinyl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(O)(c1ccc(C2CCCCC2)cn1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C19H27F3N2O3S/c20-19(21,22)18(27,9-11-28-10-8-15(23)17(25)26)16-7-6-14(12-24-16)13-4-2-1-3-5-13/h6-7,12-13,15,27H,1-5,8-11,23H2,(H,25,26) |
| InChIKey | UFXDIRDGCSQVQJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|